C20H21N4+ — CID 140839543
2,5,10-trimethyl-3-(1-methylpyrazin-1-ium-2-yl)phenazine (PubChem CID 140839543) has the molecular formula C20H21N4+ and a molecular weight of 317.42 g/mol. Its IUPAC name is 2,5,10-trimethyl-3-(1-methylpyrazin-1-ium-2-yl)phenazine.
| Compound Name | 2,5,10-trimethyl-3-(1-methylpyrazin-1-ium-2-yl)phenazine |
|---|---|
| PubChem CID | 140839543 |
| Molecular Formula | C20H21N4+ |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 2,5,10-trimethyl-3-(1-methylpyrazin-1-ium-2-yl)phenazine |
| SMILES | Cc1cc2c(cc1-c1cncc[n+]1C)N(C)c1ccccc1N2C |
| InChI | InChI=1S/C20H21N4/c1-14-11-18-19(12-15(14)20-13-21-9-10-22(20)2)24(4)17-8-6-5-7-16(17)23(18)3/h5-13H,1-4H3/q+1 |
| InChIKey | CGRFKPLGHCVYDG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 23.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|