C18H15N2O2+ — CID 140839672
1-methyl-2-(2-methyldibenzo-p-dioxin-1-yl)pyrazin-1-ium (PubChem CID 140839672) has the molecular formula C18H15N2O2+ and a molecular weight of 291.33 g/mol. Its IUPAC name is 1-methyl-2-(2-methyldibenzo-p-dioxin-1-yl)pyrazin-1-ium.
| Compound Name | 1-methyl-2-(2-methyldibenzo-p-dioxin-1-yl)pyrazin-1-ium |
|---|---|
| PubChem CID | 140839672 |
| Molecular Formula | C18H15N2O2+ |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-methyl-2-(2-methyldibenzo-p-dioxin-1-yl)pyrazin-1-ium |
| SMILES | Cc1ccc2c(c1-c1cncc[n+]1C)Oc1ccccc1O2 |
| InChI | InChI=1S/C18H15N2O2/c1-12-7-8-16-18(17(12)13-11-19-9-10-20(13)2)22-15-6-4-3-5-14(15)21-16/h3-11H,1-2H3/q+1 |
| InChIKey | JOBIOGVDMNORFX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|