C18H15N2OS+ — CID 140839651
8-methyl-9-(1-methylpyridin-1-ium-2-yl)-[1,4]benzoxathiino[3,2-b]pyridine (PubChem CID 140839651) has the molecular formula C18H15N2OS+ and a molecular weight of 307.40 g/mol. Its IUPAC name is 8-methyl-9-(1-methylpyridin-1-ium-2-yl)-[1,4]benzoxathiino[3,2-b]pyridine.
| Compound Name | 8-methyl-9-(1-methylpyridin-1-ium-2-yl)-[1,4]benzoxathiino[3,2-b]pyridine |
|---|---|
| PubChem CID | 140839651 |
| Molecular Formula | C18H15N2OS+ |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 8-methyl-9-(1-methylpyridin-1-ium-2-yl)-[1,4]benzoxathiino[3,2-b]pyridine |
| SMILES | Cc1ccc2c(c1-c1cccc[n+]1C)Sc1ncccc1O2 |
| InChI | InChI=1S/C18H15N2OS/c1-12-8-9-14-17(16(12)13-6-3-4-11-20(13)2)22-18-15(21-14)7-5-10-19-18/h3-11H,1-2H3/q+1 |
| InChIKey | GTLCJJFLHVFLBA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|