C18H20NO+ — CID 140899490
1-methyl-2-(7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane]-8-yl)pyridin-1-ium (PubChem CID 140899490) has the molecular formula C18H20NO+ and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-methyl-2-(7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane]-8-yl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane]-8-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 140899490 |
| Molecular Formula | C18H20NO+ |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-methyl-2-(7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane]-8-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c(c1-c1cccc[n+]1C)OCCC21CC1 |
| InChI | InChI=1S/C18H20NO/c1-13-6-7-14-17(20-12-10-18(14)8-9-18)16(13)15-5-3-4-11-19(15)2/h3-7,11H,8-10,12H2,1-2H3/q+1 |
| InChIKey | BEVUEYKVZQFRFV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|