C40H26FN3 — CID 171750041
3-[3-(N-(6,8-diphenylquinolin-2-yl)anilino)phenyl]-5-fluorobenzonitrile (PubChem CID 171750041) has the molecular formula C40H26FN3 and a molecular weight of 567.67 g/mol. Its IUPAC name is 3-[3-(N-(6,8-diphenylquinolin-2-yl)anilino)phenyl]-5-fluorobenzonitrile.
| Compound Name | 3-[3-(N-(6,8-diphenylquinolin-2-yl)anilino)phenyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 171750041 |
| Molecular Formula | C40H26FN3 |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 3-[3-(N-(6,8-diphenylquinolin-2-yl)anilino)phenyl]-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)cc(-c2cccc(N(c3ccccc3)c3ccc4cc(-c5ccccc5)cc(-c5ccccc5)c4n3)c2)c1 |
| InChI | InChI=1S/C40H26FN3/c41-35-22-28(27-42)21-33(24-35)31-15-10-18-37(25-31)44(36-16-8-3-9-17-36)39-20-19-32-23-34(29-11-4-1-5-12-29)26-38(40(32)43-39)30-13-6-2-7-14-30/h1-26H |
| InChIKey | CWKBKXNWMGKVDF-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |