About 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate
1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate (PubChem CID 171750511) has the molecular formula C15H18O4Se
and a molecular weight of 341.26 g/mol. Its IUPAC name is 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate |
| PubChem CID | 171750511 |
| Molecular Formula | C15H18O4Se |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C)(C(=O)OC)C(=O)OC[Se]c1ccccc1 |
| InChI | InChI=1S/C15H18O4Se/c1-4-10-15(2,13(16)18-3)14(17)19-11-20-12-8-6-5-7-9-12/h4-9H,1,10-11H2,2-3H3 |
| InChIKey | BEKXAGLEFVXFBG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate?
The IUPAC name of 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate (CID 171750511) is 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate.
What is the SMILES notation for 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate?
The canonical SMILES for 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate is C=CCC(C)(C(=O)OC)C(=O)OC[Se]c1ccccc1.
What is the InChIKey of 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate?
The InChIKey is BEKXAGLEFVXFBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O4Se/c1-4-10-15(2,13(16)18-3)14(17)19-11-20-12-8-6-5-7-9-12/h4-9H,1,10-11H2,2-3H3.
What are the key properties of 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate?
1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate has a molecular weight of 341.26 g/mol, XLogP of 1.27, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 3-O-(phenylselanylmethyl) 2-methyl-2-prop-2-enylpropanedioate is sourced from PubChem (CID 171750511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).