C20H26O5 — CID 101128128
dimethyl 2-[(2E)-3-(1-methoxy-2-phenylethyl)penta-2,4-dienyl]-2-methylpropanedioate (PubChem CID 101128128) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is dimethyl 2-[(2E)-3-(1-methoxy-2-phenylethyl)penta-2,4-dienyl]-2-methylpropanedioate.
| Compound Name | dimethyl 2-[(2E)-3-(1-methoxy-2-phenylethyl)penta-2,4-dienyl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 101128128 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | dimethyl 2-[(2E)-3-(1-methoxy-2-phenylethyl)penta-2,4-dienyl]-2-methylpropanedioate |
| SMILES | C=C/C(=C\CC(C)(C(=O)OC)C(=O)OC)C(Cc1ccccc1)OC |
| InChI | InChI=1S/C20H26O5/c1-6-16(17(23-3)14-15-10-8-7-9-11-15)12-13-20(2,18(21)24-4)19(22)25-5/h6-12,17H,1,13-14H2,2-5H3/b16-12+ |
| InChIKey | KATQVUUZWCSIMT-FOWTUZBSSA-N |
| XLogP | 3.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|