C35H34BNO2 — CID 171750917
5,28-ditert-butyl-21-deuterio-18,24-dioxa-5-aza-1-boraoctacyclo[17.11.1.02,17.04,15.06,14.09,13.023,31.025,30]hentriaconta-2,4(15),6(14),7,9(13),16,19,21,23(31),25(30),26,28-dodecaene (PubChem CID 171750917) has the molecular formula C35H34BNO2 and a molecular weight of 512.48 g/mol. Its IUPAC name is 5,28-ditert-butyl-21-deuterio-18,24-dioxa-5-aza-1-boraoctacyclo[17.11.1.02,17.04,15.06,14.09,13.023,31.025,30]hentriaconta-2,4(15),6(14),7,9(13),16,19,21,23(31),25(30),26,28-dodecaene.
| Compound Name | 5,28-ditert-butyl-21-deuterio-18,24-dioxa-5-aza-1-boraoctacyclo[17.11.1.02,17.04,15.06,14.09,13.023,31.025,30]hentriaconta-2,4(15),6(14),7,9(13),16,19,21,23(31),25(30),26,28-dodecaene |
|---|---|
| PubChem CID | 171750917 |
| Molecular Formula | C35H34BNO2 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 5,28-ditert-butyl-21-deuterio-18,24-dioxa-5-aza-1-boraoctacyclo[17.11.1.02,17.04,15.06,14.09,13.023,31.025,30]hentriaconta-2,4(15),6(14),7,9(13),16,19,21,23(31),25(30),26,28-dodecaene |
| SMILES | [2H]c1cc2c3c(c1)Oc1cc4c5c6c(ccc5n(C(C)(C)C)c4cc1B3c1cc(C(C)(C)C)ccc1O2)CCC6 |
| InChI | InChI=1S/C35H34BNO2/c1-34(2,3)21-14-16-28-24(17-21)36-25-19-27-23(18-31(25)39-30-12-8-11-29(38-28)33(30)36)32-22-10-7-9-20(22)13-15-26(32)37(27)35(4,5)6/h8,11-19H,7,9-10H2,1-6H3/i8D |
| InChIKey | CPPMZRSJJJPHHQ-BNEYPBHNSA-N |
| XLogP | 7.06 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|