C34H19N5S2 — CID 171756559
5-(4-carbazol-9-yl-6-dibenzothiophen-4-yl-1,3,5-triazin-2-yl)-1,3-benzothiazole (PubChem CID 171756559) has the molecular formula C34H19N5S2 and a molecular weight of 561.70 g/mol. Its IUPAC name is 5-(4-carbazol-9-yl-6-dibenzothiophen-4-yl-1,3,5-triazin-2-yl)-1,3-benzothiazole.
| Compound Name | 5-(4-carbazol-9-yl-6-dibenzothiophen-4-yl-1,3,5-triazin-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 171756559 |
| Molecular Formula | C34H19N5S2 |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | 5-(4-carbazol-9-yl-6-dibenzothiophen-4-yl-1,3,5-triazin-2-yl)-1,3-benzothiazole |
| SMILES | c1ccc2c(c1)sc1c(-c3nc(-c4ccc5scnc5c4)nc(-n4c5ccccc5c5ccccc54)n3)cccc12 |
| InChI | InChI=1S/C34H19N5S2/c1-4-13-27-21(8-1)22-9-2-5-14-28(22)39(27)34-37-32(20-16-17-30-26(18-20)35-19-40-30)36-33(38-34)25-12-7-11-24-23-10-3-6-15-29(23)41-31(24)25/h1-19H |
| InChIKey | QAAWKVOPYOLSKH-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |