C20H20N2O5 — CID 17176026
(E)-3-(3-nitrophenyl)-N-[4-(oxolan-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 17176026) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is (E)-3-(3-nitrophenyl)-N-[4-(oxolan-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-nitrophenyl)-N-[4-(oxolan-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17176026 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (E)-3-(3-nitrophenyl)-N-[4-(oxolan-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Nc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C20H20N2O5/c23-20(11-6-15-3-1-4-17(13-15)22(24)25)21-16-7-9-18(10-8-16)27-14-19-5-2-12-26-19/h1,3-4,6-11,13,19H,2,5,12,14H2,(H,21,23)/b11-6+ |
| InChIKey | DRSPFDMFMSIBGH-IZZDOVSWSA-N |
| XLogP | 3.80 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|