C36H47N5O3Si — CID 171761355
8-[5-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-2-(2-trimethylsilylethoxymethylamino)pyridine-3-carboximidoyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 171761355) has the molecular formula C36H47N5O3Si and a molecular weight of 625.89 g/mol. Its IUPAC name is 8-[5-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-2-(2-trimethylsilylethoxymethylamino)pyridine-3-carboximidoyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
| Compound Name | 8-[5-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-2-(2-trimethylsilylethoxymethylamino)pyridine-3-carboximidoyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 171761355 |
| Molecular Formula | C36H47N5O3Si |
| Molecular Weight | 625.89 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | 8-[5-(3-cyclopentyl-1,2,4,5-tetrahydro-3-benzazepin-7-yl)-2-(2-trimethylsilylethoxymethylamino)pyridine-3-carboximidoyl]-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | [H]/N=C(\c1ccc2c(c1)OCCNC2=O)c1cc(-c2ccc3c(c2)CCN(C2CCCC2)CC3)cnc1NCOCC[Si](C)(C)C |
| InChI | InChI=1S/C36H47N5O3Si/c1-45(2,3)19-18-43-24-40-35-32(34(37)28-10-11-31-33(22-28)44-17-14-38-36(31)42)21-29(23-39-35)26-9-8-25-12-15-41(16-13-27(25)20-26)30-6-4-5-7-30/h8-11,20-23,30,37H,4-7,12-19,24H2,1-3H3,(H,38,42)(H,39,40)/b37-34+ |
| InChIKey | NUBFRDFKEPRPBJ-NFSLGCCLSA-N |
| XLogP | 6.35 |
| TPSA | 99.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.89 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|