C27H40N4O5 — CID 154570948
8-(1-cyclohexylpiperidine-3-carbonyl)-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione (PubChem CID 154570948) has the molecular formula C27H40N4O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is 8-(1-cyclohexylpiperidine-3-carbonyl)-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione.
| Compound Name | 8-(1-cyclohexylpiperidine-3-carbonyl)-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
|---|---|
| PubChem CID | 154570948 |
| Molecular Formula | C27H40N4O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | 8-(1-cyclohexylpiperidine-3-carbonyl)-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
| SMILES | COc1ccc2c(c1)OCCNC(=O)CN(C(=O)C1CCCN(C3CCCCC3)C1)CCCNC2=O |
| InChI | InChI=1S/C27H40N4O5/c1-35-22-10-11-23-24(17-22)36-16-13-28-25(32)19-31(15-6-12-29-26(23)33)27(34)20-7-5-14-30(18-20)21-8-3-2-4-9-21/h10-11,17,20-21H,2-9,12-16,18-19H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | CUTAXEFARKIILE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |