C25H27N5O5 — CID 154565378
17-methoxy-8-[3-(1H-pyrazol-4-yl)benzoyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione (PubChem CID 154565378) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is 17-methoxy-8-[3-(1H-pyrazol-4-yl)benzoyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione.
| Compound Name | 17-methoxy-8-[3-(1H-pyrazol-4-yl)benzoyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
|---|---|
| PubChem CID | 154565378 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 17-methoxy-8-[3-(1H-pyrazol-4-yl)benzoyl]-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
| SMILES | COc1ccc2c(c1)OCCNC(=O)CN(C(=O)c1cccc(-c3cn[nH]c3)c1)CCCNC2=O |
| InChI | InChI=1S/C25H27N5O5/c1-34-20-6-7-21-22(13-20)35-11-9-26-23(31)16-30(10-3-8-27-24(21)32)25(33)18-5-2-4-17(12-18)19-14-28-29-15-19/h2,4-7,12-15H,3,8-11,16H2,1H3,(H,26,31)(H,27,32)(H,28,29) |
| InChIKey | UYLHEZHTDJWIQC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |