C23H27N3O8S — CID 154567310
8-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione (PubChem CID 154567310) has the molecular formula C23H27N3O8S and a molecular weight of 505.55 g/mol. Its IUPAC name is 8-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione.
| Compound Name | 8-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
|---|---|
| PubChem CID | 154567310 |
| Molecular Formula | C23H27N3O8S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 8-(2,3-dihydro-1,4-benzodioxin-5-ylsulfonyl)-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
| SMILES | COc1ccc2c(c1)OCCNC(=O)CN(S(=O)(=O)c1cccc3c1OCCO3)CCCNC2=O |
| InChI | InChI=1S/C23H27N3O8S/c1-31-16-6-7-17-19(14-16)32-11-9-24-21(27)15-26(10-3-8-25-23(17)28)35(29,30)20-5-2-4-18-22(20)34-13-12-33-18/h2,4-7,14H,3,8-13,15H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | COVASGQROCFRIV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |