C26H37N5O7S — CID 163340956
acetic acid;8-[2-[(1S)-1-amino-3-methylbutyl]-1,3-thiazole-4-carbonyl]-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione (PubChem CID 163340956) has the molecular formula C26H37N5O7S and a molecular weight of 563.68 g/mol. Its IUPAC name is acetic acid;8-[2-[(1S)-1-amino-3-methylbutyl]-1,3-thiazole-4-carbonyl]-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione.
| Compound Name | acetic acid;8-[2-[(1S)-1-amino-3-methylbutyl]-1,3-thiazole-4-carbonyl]-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
|---|---|
| PubChem CID | 163340956 |
| Molecular Formula | C26H37N5O7S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | acetic acid;8-[2-[(1S)-1-amino-3-methylbutyl]-1,3-thiazole-4-carbonyl]-17-methoxy-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-6,13-dione |
| SMILES | CC(=O)O.COc1ccc2c(c1)OCCNC(=O)CN(C(=O)c1csc([C@@H](N)CC(C)C)n1)CCCNC2=O |
| InChI | InChI=1S/C24H33N5O5S.C2H4O2/c1-15(2)11-18(25)23-28-19(14-35-23)24(32)29-9-4-7-27-22(31)17-6-5-16(33-3)12-20(17)34-10-8-26-21(30)13-29;1-2(3)4/h5-6,12,14-15,18H,4,7-11,13,25H2,1-3H3,(H,26,30)(H,27,31);1H3,(H,3,4)/t18-;/m0./s1 |
| InChIKey | XMIAHQKWQMWQBM-FERBBOLQSA-N |
| XLogP | 2.06 |
| TPSA | 173.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |