C17H26N4O6S — CID 154569098
17-methoxy-N,N-dimethyl-6,13-dioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-8-sulfonamide (PubChem CID 154569098) has the molecular formula C17H26N4O6S and a molecular weight of 414.48 g/mol. Its IUPAC name is 17-methoxy-N,N-dimethyl-6,13-dioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-8-sulfonamide.
| Compound Name | 17-methoxy-N,N-dimethyl-6,13-dioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-8-sulfonamide |
|---|---|
| PubChem CID | 154569098 |
| Molecular Formula | C17H26N4O6S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 17-methoxy-N,N-dimethyl-6,13-dioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(14),15,17-triene-8-sulfonamide |
| SMILES | COc1ccc2c(c1)OCCNC(=O)CN(S(=O)(=O)N(C)C)CCCNC2=O |
| InChI | InChI=1S/C17H26N4O6S/c1-20(2)28(24,25)21-9-4-7-19-17(23)14-6-5-13(26-3)11-15(14)27-10-8-18-16(22)12-21/h5-6,11H,4,7-10,12H2,1-3H3,(H,18,22)(H,19,23) |
| InChIKey | DLIMDPOZWAVLNQ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |