C42H30IrN4-2 — CID 171766173
iridium;5-[4-methyl-3-(2-methyl-5-pyridin-2-ylbenzene-4-id-1-yl)phenyl]-4,7-phenanthroline;2-phenylpyridine (PubChem CID 171766173) has the molecular formula C42H30IrN4-2 and a molecular weight of 782.95 g/mol. Its IUPAC name is iridium;5-[4-methyl-3-(2-methyl-5-pyridin-2-ylbenzene-4-id-1-yl)phenyl]-4,7-phenanthroline;2-phenylpyridine.
| Compound Name | iridium;5-[4-methyl-3-(2-methyl-5-pyridin-2-ylbenzene-4-id-1-yl)phenyl]-4,7-phenanthroline;2-phenylpyridine |
|---|---|
| PubChem CID | 171766173 |
| Molecular Formula | C42H30IrN4-2 |
| Molecular Weight | 782.95 g/mol |
| Exact Mass | 783.21 |
| IUPAC Name | iridium;5-[4-methyl-3-(2-methyl-5-pyridin-2-ylbenzene-4-id-1-yl)phenyl]-4,7-phenanthroline;2-phenylpyridine |
| SMILES | Cc1c[c-]c(-c2ccccn2)cc1-c1cc(-c2cc3ncccc3c3cccnc23)ccc1C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C31H22N3.C11H8N.Ir/c1-20-10-12-22(28-19-30-24(7-5-15-33-30)25-8-6-16-34-31(25)28)17-26(20)27-18-23(13-11-21(27)2)29-9-3-4-14-32-29;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-12,14-19H,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | GCYLGUAYUAFQMD-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.95 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|