C32H26N4 — CID 171766331
2,8-dimethyl-6-[6-[2-methyl-5-(4-methyl-2-pyridinyl)phenyl]pyrazin-2-yl]benzo[f]quinoline (PubChem CID 171766331) has the molecular formula C32H26N4 and a molecular weight of 466.59 g/mol. Its IUPAC name is 2,8-dimethyl-6-[6-[2-methyl-5-(4-methyl-2-pyridinyl)phenyl]pyrazin-2-yl]benzo[f]quinoline.
| Compound Name | 2,8-dimethyl-6-[6-[2-methyl-5-(4-methyl-2-pyridinyl)phenyl]pyrazin-2-yl]benzo[f]quinoline |
|---|---|
| PubChem CID | 171766331 |
| Molecular Formula | C32H26N4 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 2,8-dimethyl-6-[6-[2-methyl-5-(4-methyl-2-pyridinyl)phenyl]pyrazin-2-yl]benzo[f]quinoline |
| SMILES | Cc1ccnc(-c2ccc(C)c(-c3cncc(-c4cc5ncc(C)cc5c5ccc(C)cc45)n3)c2)c1 |
| InChI | InChI=1S/C32H26N4/c1-19-5-8-24-26(11-19)28(15-30-27(24)12-21(3)16-35-30)32-18-33-17-31(36-32)25-14-23(7-6-22(25)4)29-13-20(2)9-10-34-29/h5-18H,1-4H3 |
| InChIKey | LKQPAJOCQWJFPR-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|