C31H24N4 — CID 171766337
2,9-dimethyl-6-[6-[3-(4-methyl-2-pyridinyl)phenyl]pyrazin-2-yl]benzo[f]quinoline (PubChem CID 171766337) has the molecular formula C31H24N4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2,9-dimethyl-6-[6-[3-(4-methyl-2-pyridinyl)phenyl]pyrazin-2-yl]benzo[f]quinoline.
| Compound Name | 2,9-dimethyl-6-[6-[3-(4-methyl-2-pyridinyl)phenyl]pyrazin-2-yl]benzo[f]quinoline |
|---|---|
| PubChem CID | 171766337 |
| Molecular Formula | C31H24N4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 2,9-dimethyl-6-[6-[3-(4-methyl-2-pyridinyl)phenyl]pyrazin-2-yl]benzo[f]quinoline |
| SMILES | Cc1ccnc(-c2cccc(-c3cncc(-c4cc5ncc(C)cc5c5cc(C)ccc45)n3)c2)c1 |
| InChI | InChI=1S/C31H24N4/c1-19-7-8-24-25(11-19)26-12-21(3)16-34-29(26)15-27(24)31-18-32-17-30(35-31)23-6-4-5-22(14-23)28-13-20(2)9-10-33-28/h4-18H,1-3H3 |
| InChIKey | DDCUCDJQVIJVKL-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|