C15H9N3O — CID 171768052
6-pyridin-2-yl-8-oxa-4,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 171768052) has the molecular formula C15H9N3O and a molecular weight of 247.26 g/mol. Its IUPAC name is 6-pyridin-2-yl-8-oxa-4,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 6-pyridin-2-yl-8-oxa-4,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 171768052 |
| Molecular Formula | C15H9N3O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 6-pyridin-2-yl-8-oxa-4,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1ccc(-c2cncc3c2oc2ncccc23)nc1 |
| InChI | InChI=1S/C15H9N3O/c1-2-6-17-13(5-1)12-9-16-8-11-10-4-3-7-18-15(10)19-14(11)12/h1-9H |
| InChIKey | MSIVWQGHJRLBEF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |