C18H13NO — CID 90139251
8-[4-(trideuteriomethyl)phenyl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 90139251) has the molecular formula C18H13NO and a molecular weight of 262.33 g/mol. Its IUPAC name is 8-[4-(trideuteriomethyl)phenyl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[4-(trideuteriomethyl)phenyl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 90139251 |
| Molecular Formula | C18H13NO |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 8-[4-(trideuteriomethyl)phenyl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cccc3c2oc2ncccc23)cc1 |
| InChI | InChI=1S/C18H13NO/c1-12-7-9-13(10-8-12)14-4-2-5-15-16-6-3-11-19-18(16)20-17(14)15/h2-11H,1H3/i1D3 |
| InChIKey | XQOISOIKMSTGFI-FIBGUPNXSA-N |
| XLogP | 4.96 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |