C23H26ClN5O5 — CID 17177067
N-[2-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 17177067) has the molecular formula C23H26ClN5O5 and a molecular weight of 487.94 g/mol. Its IUPAC name is N-[2-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[2-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 17177067 |
| Molecular Formula | C23H26ClN5O5 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-[2-(4-acetylpiperazin-1-yl)-3-chlorophenyl]-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | CC(=O)N1CCN(c2c(Cl)cccc2NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)CC1 |
| InChI | InChI=1S/C23H26ClN5O5/c1-16(30)26-7-9-28(10-8-26)22-19(24)3-2-4-20(22)25-23(31)18-15-17(29(32)33)5-6-21(18)27-11-13-34-14-12-27/h2-6,15H,7-14H2,1H3,(H,25,31) |
| InChIKey | OQSWUGBURJVBDL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|