C15H15BrClNO2 — CID 171773463
1-bromo-3-[3-chloro-4-(pyridin-3-yloxymethyl)phenyl]propan-2-ol (PubChem CID 171773463) has the molecular formula C15H15BrClNO2 and a molecular weight of 356.65 g/mol. Its IUPAC name is 1-bromo-3-[3-chloro-4-(pyridin-3-yloxymethyl)phenyl]propan-2-ol.
| Compound Name | 1-bromo-3-[3-chloro-4-(pyridin-3-yloxymethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 171773463 |
| Molecular Formula | C15H15BrClNO2 |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 1-bromo-3-[3-chloro-4-(pyridin-3-yloxymethyl)phenyl]propan-2-ol |
| SMILES | OC(CBr)Cc1ccc(COc2cccnc2)c(Cl)c1 |
| InChI | InChI=1S/C15H15BrClNO2/c16-8-13(19)6-11-3-4-12(15(17)7-11)10-20-14-2-1-5-18-9-14/h1-5,7,9,13,19H,6,8,10H2 |
| InChIKey | NNXNZZNDHXFPQJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|