About 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid
2-aminoacetic acid;cerium;cyclohexanecarboxylic acid (PubChem CID 171776246) has the molecular formula C9H17CeNO4
and a molecular weight of 343.35 g/mol. Its IUPAC name is 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid.
Molecular Properties
| Compound Name | 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid |
| PubChem CID | 171776246 |
| Molecular Formula | C9H17CeNO4 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid |
| SMILES | NCC(=O)O.O=C(O)C1CCCCC1.[Ce] |
| InChI | InChI=1S/C7H12O2.C2H5NO2.Ce/c8-7(9)6-4-2-1-3-5-6;3-1-2(4)5;/h6H,1-5H2,(H,8,9);1,3H2,(H,4,5); |
| InChIKey | MKGBKJCYQFSTDO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid?
The IUPAC name of 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid (CID 171776246) is 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid.
What is the SMILES notation for 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid?
The canonical SMILES for 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid is NCC(=O)O.O=C(O)C1CCCCC1.[Ce].
What is the InChIKey of 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid?
The InChIKey is MKGBKJCYQFSTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C2H5NO2.Ce/c8-7(9)6-4-2-1-3-5-6;3-1-2(4)5;/h6H,1-5H2,(H,8,9);1,3H2,(H,4,5);.
What are the key properties of 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid?
2-aminoacetic acid;cerium;cyclohexanecarboxylic acid has a molecular weight of 343.35 g/mol, XLogP of 0.68, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;cerium;cyclohexanecarboxylic acid is sourced from PubChem (CID 171776246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).