About cyclohexanecarboxylic acid;diiminoazanium
cyclohexanecarboxylic acid;diiminoazanium (PubChem CID 174800103) has the molecular formula C7H14N3O2+
and a molecular weight of 172.21 g/mol. Its IUPAC name is cyclohexanecarboxylic acid;diiminoazanium.
Molecular Properties
| Compound Name | cyclohexanecarboxylic acid;diiminoazanium |
| PubChem CID | 174800103 |
| Molecular Formula | C7H14N3O2+ |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | cyclohexanecarboxylic acid;diiminoazanium |
| SMILES | N=[N+]=N.O=C(O)C1CCCCC1 |
| InChI | InChI=1S/C7H12O2.H2N3/c8-7(9)6-4-2-1-3-5-6;1-3-2/h6H,1-5H2,(H,8,9);1-2H/q;+1 |
| InChIKey | DIPQIRABHFJTTL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanecarboxylic acid;diiminoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanecarboxylic acid;diiminoazanium?
The IUPAC name of cyclohexanecarboxylic acid;diiminoazanium (CID 174800103) is cyclohexanecarboxylic acid;diiminoazanium.
What is the SMILES notation for cyclohexanecarboxylic acid;diiminoazanium?
The canonical SMILES for cyclohexanecarboxylic acid;diiminoazanium is N=[N+]=N.O=C(O)C1CCCCC1.
What is the InChIKey of cyclohexanecarboxylic acid;diiminoazanium?
The InChIKey is DIPQIRABHFJTTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.H2N3/c8-7(9)6-4-2-1-3-5-6;1-3-2/h6H,1-5H2,(H,8,9);1-2H/q;+1.
What are the key properties of cyclohexanecarboxylic acid;diiminoazanium?
cyclohexanecarboxylic acid;diiminoazanium has a molecular weight of 172.21 g/mol, XLogP of 1.77, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanecarboxylic acid;diiminoazanium is sourced from PubChem (CID 174800103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).