C14H15N5O4S2 — CID 171777306
5-[[5-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 171777306) has the molecular formula C14H15N5O4S2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 5-[[5-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[[5-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 171777306 |
| Molecular Formula | C14H15N5O4S2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 5-[[5-(3,4,5-trimethoxyphenyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | COc1cc(-c2nc(SCc3n[nH]c(=S)o3)n[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C14H15N5O4S2/c1-20-8-4-7(5-9(21-2)11(8)22-3)12-15-13(18-17-12)25-6-10-16-19-14(24)23-10/h4-5H,6H2,1-3H3,(H,19,24)(H,15,17,18) |
| InChIKey | FYNUIZLZQDIUAN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 111.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|