C15H10ClN5O — CID 171779034
1-[4-chloro-2-(2-methoxy-4-pyridinyl)phenyl]triazole-4-carbonitrile (PubChem CID 171779034) has the molecular formula C15H10ClN5O and a molecular weight of 311.73 g/mol. Its IUPAC name is 1-[4-chloro-2-(2-methoxy-4-pyridinyl)phenyl]triazole-4-carbonitrile.
| Compound Name | 1-[4-chloro-2-(2-methoxy-4-pyridinyl)phenyl]triazole-4-carbonitrile |
|---|---|
| PubChem CID | 171779034 |
| Molecular Formula | C15H10ClN5O |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 1-[4-chloro-2-(2-methoxy-4-pyridinyl)phenyl]triazole-4-carbonitrile |
| SMILES | COc1cc(-c2cc(Cl)ccc2-n2cc(C#N)nn2)ccn1 |
| InChI | InChI=1S/C15H10ClN5O/c1-22-15-6-10(4-5-18-15)13-7-11(16)2-3-14(13)21-9-12(8-17)19-20-21/h2-7,9H,1H3 |
| InChIKey | XOEMUZLXASMYDS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |