C6H6ClF3O3 — CID 171780436
methyl 2-(chloromethyl)-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 171780436) has the molecular formula C6H6ClF3O3 and a molecular weight of 218.56 g/mol. Its IUPAC name is methyl 2-(chloromethyl)-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | methyl 2-(chloromethyl)-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 171780436 |
| Molecular Formula | C6H6ClF3O3 |
| Molecular Weight | 218.56 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | methyl 2-(chloromethyl)-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | COC(=O)C(CCl)C(=O)C(F)(F)F |
| InChI | InChI=1S/C6H6ClF3O3/c1-13-5(12)3(2-7)4(11)6(8,9)10/h3H,2H2,1H3 |
| InChIKey | GGCQCDATJKWWPI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.56 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|