C20H24N2O2 — CID 171782007
(9aR)-8-(2-phenylmethoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 171782007) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is (9aR)-8-(2-phenylmethoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (9aR)-8-(2-phenylmethoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 171782007 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | (9aR)-8-(2-phenylmethoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | c1ccc(COc2ccccc2N2CCN3CCOC[C@H]3C2)cc1 |
| InChI | InChI=1S/C20H24N2O2/c1-2-6-17(7-3-1)15-24-20-9-5-4-8-19(20)22-11-10-21-12-13-23-16-18(21)14-22/h1-9,18H,10-16H2/t18-/m1/s1 |
| InChIKey | OLUCKHMTGCKTTE-GOSISDBHSA-N |
| XLogP | 2.79 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |