C17H23N5OS — CID 171782345
5-methyl-1-(3-methylsulfanylbutan-2-yl)-N-prop-2-enyl-N-pyridazin-4-ylpyrazole-4-carboxamide (PubChem CID 171782345) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is 5-methyl-1-(3-methylsulfanylbutan-2-yl)-N-prop-2-enyl-N-pyridazin-4-ylpyrazole-4-carboxamide.
| Compound Name | 5-methyl-1-(3-methylsulfanylbutan-2-yl)-N-prop-2-enyl-N-pyridazin-4-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 171782345 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 5-methyl-1-(3-methylsulfanylbutan-2-yl)-N-prop-2-enyl-N-pyridazin-4-ylpyrazole-4-carboxamide |
| SMILES | C=CCN(C(=O)c1cnn(C(C)C(C)SC)c1C)c1ccnnc1 |
| InChI | InChI=1S/C17H23N5OS/c1-6-9-21(15-7-8-18-19-10-15)17(23)16-11-20-22(13(16)3)12(2)14(4)24-5/h6-8,10-12,14H,1,9H2,2-5H3 |
| InChIKey | CMHUYTVAKOKTOM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|