C11H9F2NO2S2 — CID 171784623
ethyl (E)-2,2-difluoro-4-thiocyanato-4-thiophen-2-ylbut-3-enoate (PubChem CID 171784623) has the molecular formula C11H9F2NO2S2 and a molecular weight of 289.33 g/mol. Its IUPAC name is ethyl (E)-2,2-difluoro-4-thiocyanato-4-thiophen-2-ylbut-3-enoate.
| Compound Name | ethyl (E)-2,2-difluoro-4-thiocyanato-4-thiophen-2-ylbut-3-enoate |
|---|---|
| PubChem CID | 171784623 |
| Molecular Formula | C11H9F2NO2S2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | ethyl (E)-2,2-difluoro-4-thiocyanato-4-thiophen-2-ylbut-3-enoate |
| SMILES | CCOC(=O)C(F)(F)/C=C(/SC#N)c1cccs1 |
| InChI | InChI=1S/C11H9F2NO2S2/c1-2-16-10(15)11(12,13)6-9(18-7-14)8-4-3-5-17-8/h3-6H,2H2,1H3/b9-6+ |
| InChIKey | USETVWOHDHDVSF-RMKNXTFCSA-N |
| XLogP | 3.50 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|