C9H11F2NO2S — CID 171243650
ethyl (3S)-3-amino-2,2-difluoro-3-thiophen-2-ylpropanoate (PubChem CID 171243650) has the molecular formula C9H11F2NO2S and a molecular weight of 235.25 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2,2-difluoro-3-thiophen-2-ylpropanoate.
| Compound Name | ethyl (3S)-3-amino-2,2-difluoro-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 171243650 |
| Molecular Formula | C9H11F2NO2S |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | ethyl (3S)-3-amino-2,2-difluoro-3-thiophen-2-ylpropanoate |
| SMILES | CCOC(=O)C(F)(F)[C@H](N)c1cccs1 |
| InChI | InChI=1S/C9H11F2NO2S/c1-2-14-8(13)9(10,11)7(12)6-4-3-5-15-6/h3-5,7H,2,12H2,1H3/t7-/m1/s1 |
| InChIKey | CMMIAXSXHVAMOS-SSDOTTSWSA-N |
| XLogP | 1.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |