C29H43NO2 — CID 171785036
3-[(4bR,7S)-7-hydroxy-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-1-yl]-N-[(3-methylphenyl)methyl]propanamide (PubChem CID 171785036) has the molecular formula C29H43NO2 and a molecular weight of 437.67 g/mol. Its IUPAC name is 3-[(4bR,7S)-7-hydroxy-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-1-yl]-N-[(3-methylphenyl)methyl]propanamide.
| Compound Name | 3-[(4bR,7S)-7-hydroxy-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-1-yl]-N-[(3-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 171785036 |
| Molecular Formula | C29H43NO2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | 3-[(4bR,7S)-7-hydroxy-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-1-yl]-N-[(3-methylphenyl)methyl]propanamide |
| SMILES | CC1=C(CCC(=O)NCc2cccc(C)c2)C2CCC3C(C)(C)[C@@H](O)CC[C@]3(C)C2CC1 |
| InChI | InChI=1S/C29H43NO2/c1-19-7-6-8-21(17-19)18-30-27(32)14-11-22-20(2)9-12-24-23(22)10-13-25-28(3,4)26(31)15-16-29(24,25)5/h6-8,17,23-26,31H,9-16,18H2,1-5H3,(H,30,32)/t23?,24?,25?,26-,29+/m0/s1 |
| InChIKey | QODMSEKHJHSDHG-AHIQAJPESA-N |
| XLogP | 6.33 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|