C11H7ClF3N3O — CID 171785766
1-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-4-carbonyl chloride (PubChem CID 171785766) has the molecular formula C11H7ClF3N3O and a molecular weight of 289.64 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-4-carbonyl chloride.
| Compound Name | 1-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 171785766 |
| Molecular Formula | C11H7ClF3N3O |
| Molecular Weight | 289.64 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 1-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-4-carbonyl chloride |
| SMILES | O=C(Cl)c1cn(Cc2ccccn2)nc1C(F)(F)F |
| InChI | InChI=1S/C11H7ClF3N3O/c12-10(19)8-6-18(17-9(8)11(13,14)15)5-7-3-1-2-4-16-7/h1-4,6H,5H2 |
| InChIKey | ITYPIOACHPVCJC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|