C28H28F2N4O — CID 171786136
ethane;5-ethynyl-6-fluoro-4-[8-fluoro-2-methyl-4-(2,3,6,7-tetrahydroazepin-1-yl)-1,2-dihydropyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol (PubChem CID 171786136) has the molecular formula C28H28F2N4O and a molecular weight of 474.56 g/mol. Its IUPAC name is ethane;5-ethynyl-6-fluoro-4-[8-fluoro-2-methyl-4-(2,3,6,7-tetrahydroazepin-1-yl)-1,2-dihydropyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol.
| Compound Name | ethane;5-ethynyl-6-fluoro-4-[8-fluoro-2-methyl-4-(2,3,6,7-tetrahydroazepin-1-yl)-1,2-dihydropyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 171786136 |
| Molecular Formula | C28H28F2N4O |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | ethane;5-ethynyl-6-fluoro-4-[8-fluoro-2-methyl-4-(2,3,6,7-tetrahydroazepin-1-yl)-1,2-dihydropyrido[4,3-d]pyrimidin-7-yl]naphthalen-2-ol |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3ncc4c(c3F)NC(C)N=C4N3CCC=CCC3)c12.CC |
| InChI | InChI=1S/C26H22F2N4O.C2H6/c1-3-18-21(27)9-8-16-12-17(33)13-19(22(16)18)24-23(28)25-20(14-29-24)26(31-15(2)30-25)32-10-6-4-5-7-11-32;1-2/h1,4-5,8-9,12-15,30,33H,6-7,10-11H2,2H3;1-2H3 |
| InChIKey | KZNRUCAUAUJIDL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|