C24H21F2N5O — CID 171083805
4-[4-amino-5-(3,8-diazabicyclo[3.2.1]octane-3-carboximidoyl)-3-fluoro-2-pyridinyl]-5-ethynyl-6-fluoronaphthalen-2-ol (PubChem CID 171083805) has the molecular formula C24H21F2N5O and a molecular weight of 433.46 g/mol. Its IUPAC name is 4-[4-amino-5-(3,8-diazabicyclo[3.2.1]octane-3-carboximidoyl)-3-fluoro-2-pyridinyl]-5-ethynyl-6-fluoronaphthalen-2-ol.
| Compound Name | 4-[4-amino-5-(3,8-diazabicyclo[3.2.1]octane-3-carboximidoyl)-3-fluoro-2-pyridinyl]-5-ethynyl-6-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 171083805 |
| Molecular Formula | C24H21F2N5O |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-[4-amino-5-(3,8-diazabicyclo[3.2.1]octane-3-carboximidoyl)-3-fluoro-2-pyridinyl]-5-ethynyl-6-fluoronaphthalen-2-ol |
| SMILES | [H]/N=C(/c1cnc(-c2cc(O)cc3ccc(F)c(C#C)c23)c(F)c1N)N1CC2CCC(C1)N2 |
| InChI | InChI=1S/C24H21F2N5O/c1-2-16-19(25)6-3-12-7-15(32)8-17(20(12)16)23-21(26)22(27)18(9-29-23)24(28)31-10-13-4-5-14(11-31)30-13/h1,3,6-9,13-14,28,30,32H,4-5,10-11H2,(H2,27,29)/b28-24- |
| InChIKey | HHMLHFPFGUAROW-COOPMVRXSA-N |
| XLogP | 3.21 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|