C26H29F8N5O4 — CID 171790393
N-[1-(4,4-difluorocyclohexyl)-2-oxo-2-[[4-[3,3,3-trifluoro-1-(4,4,4-trifluorobutanoylamino)propyl]-2-pyridinyl]amino]ethyl]-4-ethyl-1,2-oxazole-5-carboxamide (PubChem CID 171790393) has the molecular formula C26H29F8N5O4 and a molecular weight of 627.53 g/mol. Its IUPAC name is N-[1-(4,4-difluorocyclohexyl)-2-oxo-2-[[4-[3,3,3-trifluoro-1-(4,4,4-trifluorobutanoylamino)propyl]-2-pyridinyl]amino]ethyl]-4-ethyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-[1-(4,4-difluorocyclohexyl)-2-oxo-2-[[4-[3,3,3-trifluoro-1-(4,4,4-trifluorobutanoylamino)propyl]-2-pyridinyl]amino]ethyl]-4-ethyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 171790393 |
| Molecular Formula | C26H29F8N5O4 |
| Molecular Weight | 627.53 g/mol |
| Exact Mass | 627.21 |
| IUPAC Name | N-[1-(4,4-difluorocyclohexyl)-2-oxo-2-[[4-[3,3,3-trifluoro-1-(4,4,4-trifluorobutanoylamino)propyl]-2-pyridinyl]amino]ethyl]-4-ethyl-1,2-oxazole-5-carboxamide |
| SMILES | CCc1cnoc1C(=O)NC(C(=O)Nc1cc(C(CC(F)(F)F)NC(=O)CCC(F)(F)F)ccn1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C26H29F8N5O4/c1-2-14-13-36-43-21(14)23(42)39-20(15-3-7-24(27,28)8-4-15)22(41)38-18-11-16(6-10-35-18)17(12-26(32,33)34)37-19(40)5-9-25(29,30)31/h6,10-11,13,15,17,20H,2-5,7-9,12H2,1H3,(H,37,40)(H,39,42)(H,35,38,41) |
| InChIKey | OYGIQBPCBIBGQW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |