C25H28F5N5O4 — CID 171790891
N-[(1R)-1-(4,4-difluorocyclohexyl)-2-oxo-2-[[4-[[(3S,5S)-2-oxo-5-(trifluoromethyl)pyrrolidin-3-yl]methyl]-2-pyridinyl]amino]ethyl]-5-ethyl-1,2-oxazole-4-carboxamide (PubChem CID 171790891) has the molecular formula C25H28F5N5O4 and a molecular weight of 557.52 g/mol. Its IUPAC name is N-[(1R)-1-(4,4-difluorocyclohexyl)-2-oxo-2-[[4-[[(3S,5S)-2-oxo-5-(trifluoromethyl)pyrrolidin-3-yl]methyl]-2-pyridinyl]amino]ethyl]-5-ethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(1R)-1-(4,4-difluorocyclohexyl)-2-oxo-2-[[4-[[(3S,5S)-2-oxo-5-(trifluoromethyl)pyrrolidin-3-yl]methyl]-2-pyridinyl]amino]ethyl]-5-ethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 171790891 |
| Molecular Formula | C25H28F5N5O4 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | N-[(1R)-1-(4,4-difluorocyclohexyl)-2-oxo-2-[[4-[[(3S,5S)-2-oxo-5-(trifluoromethyl)pyrrolidin-3-yl]methyl]-2-pyridinyl]amino]ethyl]-5-ethyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1oncc1C(=O)N[C@@H](C(=O)Nc1cc(C[C@H]2C[C@@H](C(F)(F)F)NC2=O)ccn1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C25H28F5N5O4/c1-2-17-16(12-32-39-17)22(37)35-20(14-3-6-24(26,27)7-4-14)23(38)34-19-10-13(5-8-31-19)9-15-11-18(25(28,29)30)33-21(15)36/h5,8,10,12,14-15,18,20H,2-4,6-7,9,11H2,1H3,(H,33,36)(H,35,37)(H,31,34,38)/t15-,18-,20+/m0/s1 |
| InChIKey | SHDUHXLXRAKZGJ-ZAAXVRCTSA-N |
| XLogP | 3.80 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |