C19H20ClN3O3S — CID 17179500
3-(2-chlorophenyl)-N-[[[2-(3-methylphenoxy)acetyl]amino]carbamothioyl]propanamide (PubChem CID 17179500) has the molecular formula C19H20ClN3O3S and a molecular weight of 405.91 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[[[2-(3-methylphenoxy)acetyl]amino]carbamothioyl]propanamide.
| Compound Name | 3-(2-chlorophenyl)-N-[[[2-(3-methylphenoxy)acetyl]amino]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 17179500 |
| Molecular Formula | C19H20ClN3O3S |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[[[2-(3-methylphenoxy)acetyl]amino]carbamothioyl]propanamide |
| SMILES | Cc1cccc(OCC(=O)NNC(=S)NC(=O)CCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O3S/c1-13-5-4-7-15(11-13)26-12-18(25)22-23-19(27)21-17(24)10-9-14-6-2-3-8-16(14)20/h2-8,11H,9-10,12H2,1H3,(H,22,25)(H2,21,23,24,27) |
| InChIKey | ABRLHCGPZAHKJC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|