C15H12N4O3 — CID 171795486
N-(2-methyl-5-nitrophenyl)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 171795486) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171795486 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)c1cnc2ccccn12 |
| InChI | InChI=1S/C15H12N4O3/c1-10-5-6-11(19(21)22)8-12(10)17-15(20)13-9-16-14-4-2-3-7-18(13)14/h2-9H,1H3,(H,17,20) |
| InChIKey | DBJOBDOYYBIFNC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|