C19H17ClN6O — CID 171795519
(1S,4R,5S,6S)-4-[(6-chloro-3-pyridinyl)methyl]-6-methyl-2-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)-2-azabicyclo[3.1.0]hexan-3-one (PubChem CID 171795519) has the molecular formula C19H17ClN6O and a molecular weight of 380.84 g/mol. Its IUPAC name is (1S,4R,5S,6S)-4-[(6-chloro-3-pyridinyl)methyl]-6-methyl-2-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)-2-azabicyclo[3.1.0]hexan-3-one.
| Compound Name | (1S,4R,5S,6S)-4-[(6-chloro-3-pyridinyl)methyl]-6-methyl-2-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)-2-azabicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 171795519 |
| Molecular Formula | C19H17ClN6O |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (1S,4R,5S,6S)-4-[(6-chloro-3-pyridinyl)methyl]-6-methyl-2-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)-2-azabicyclo[3.1.0]hexan-3-one |
| SMILES | C[C@H]1[C@@H]2[C@H]1N(c1n[nH]c(-c3ccncc3)n1)C(=O)[C@@H]2Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H17ClN6O/c1-10-15-13(8-11-2-3-14(20)22-9-11)18(27)26(16(10)15)19-23-17(24-25-19)12-4-6-21-7-5-12/h2-7,9-10,13,15-16H,8H2,1H3,(H,23,24,25)/t10-,13+,15-,16-/m0/s1 |
| InChIKey | DFUAIUBOIZHZCK-UXVLEFJLSA-N |
| XLogP | 2.76 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|