C24H21FN4O3 — CID 171796662
[(E)-1-[4-methyl-3-[(7-phenylmethoxyimidazo[1,2-a]pyridine-3-carbonyl)amino]phenyl]ethylideneamino] hypofluorite (PubChem CID 171796662) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is [(E)-1-[4-methyl-3-[(7-phenylmethoxyimidazo[1,2-a]pyridine-3-carbonyl)amino]phenyl]ethylideneamino] hypofluorite.
| Compound Name | [(E)-1-[4-methyl-3-[(7-phenylmethoxyimidazo[1,2-a]pyridine-3-carbonyl)amino]phenyl]ethylideneamino] hypofluorite |
|---|---|
| PubChem CID | 171796662 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | [(E)-1-[4-methyl-3-[(7-phenylmethoxyimidazo[1,2-a]pyridine-3-carbonyl)amino]phenyl]ethylideneamino] hypofluorite |
| SMILES | C/C(=N\OF)c1ccc(C)c(NC(=O)c2cnc3cc(OCc4ccccc4)ccn23)c1 |
| InChI | InChI=1S/C24H21FN4O3/c1-16-8-9-19(17(2)28-32-25)12-21(16)27-24(30)22-14-26-23-13-20(10-11-29(22)23)31-15-18-6-4-3-5-7-18/h3-14H,15H2,1-2H3,(H,27,30)/b28-17+ |
| InChIKey | HLYGPCOOSHNKHW-OGLMXYFKSA-N |
| XLogP | 5.10 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|