C17H23F3N6O — CID 171798288
N-(8-azabicyclo[3.2.1]octan-3-yl)-8-propan-2-yl-2-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 171798288) has the molecular formula C17H23F3N6O and a molecular weight of 384.41 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-8-propan-2-yl-2-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-8-propan-2-yl-2-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 171798288 |
| Molecular Formula | C17H23F3N6O |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-8-propan-2-yl-2-(2,2,2-trifluoroethoxy)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CC(C)c1cnn2c(NC3CC4CCC(C3)N4)nc(OCC(F)(F)F)nc12 |
| InChI | InChI=1S/C17H23F3N6O/c1-9(2)13-7-21-26-14(13)24-16(27-8-17(18,19)20)25-15(26)23-12-5-10-3-4-11(6-12)22-10/h7,9-12,22H,3-6,8H2,1-2H3,(H,23,24,25) |
| InChIKey | JUYNFGFYXMJWPN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |