C29H30BrN3O3S — CID 17179867
5-bromo-N-[[4-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide (PubChem CID 17179867) has the molecular formula C29H30BrN3O3S and a molecular weight of 580.55 g/mol. Its IUPAC name is 5-bromo-N-[[4-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | 5-bromo-N-[[4-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17179867 |
| Molecular Formula | C29H30BrN3O3S |
| Molecular Weight | 580.55 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | 5-bromo-N-[[4-(4-methylpiperidine-1-carbonyl)phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide |
| SMILES | CC1CCN(C(=O)c2ccc(NC(=S)NC(=O)c3cc(Br)ccc3OCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H30BrN3O3S/c1-20-13-16-33(17-14-20)28(35)22-7-10-24(11-8-22)31-29(37)32-27(34)25-19-23(30)9-12-26(25)36-18-15-21-5-3-2-4-6-21/h2-12,19-20H,13-18H2,1H3,(H2,31,32,34,37) |
| InChIKey | QEVGHEBNTGGSHS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.55 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|