C18H34N2OS — CID 171799849
1-[4-[1-(3-methyl-2-methylidenebutyl)piperidin-4-yl]oxypiperidin-1-yl]ethanethiol (PubChem CID 171799849) has the molecular formula C18H34N2OS and a molecular weight of 326.55 g/mol. Its IUPAC name is 1-[4-[1-(3-methyl-2-methylidenebutyl)piperidin-4-yl]oxypiperidin-1-yl]ethanethiol.
| Compound Name | 1-[4-[1-(3-methyl-2-methylidenebutyl)piperidin-4-yl]oxypiperidin-1-yl]ethanethiol |
|---|---|
| PubChem CID | 171799849 |
| Molecular Formula | C18H34N2OS |
| Molecular Weight | 326.55 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 1-[4-[1-(3-methyl-2-methylidenebutyl)piperidin-4-yl]oxypiperidin-1-yl]ethanethiol |
| SMILES | C=C(CN1CCC(OC2CCN(C(C)S)CC2)CC1)C(C)C |
| InChI | InChI=1S/C18H34N2OS/c1-14(2)15(3)13-19-9-5-17(6-10-19)21-18-7-11-20(12-8-18)16(4)22/h14,16-18,22H,3,5-13H2,1-2,4H3 |
| InChIKey | KQAYNNUNUPLTJB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|