C21H29N5O3 — CID 171799872
3-[1-[[6-[3-(2,4-dioxo-1,3-diazinan-1-yl)azetidin-1-yl]-3-pyridinyl]methyl]piperidin-4-yl]propanal (PubChem CID 171799872) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 3-[1-[[6-[3-(2,4-dioxo-1,3-diazinan-1-yl)azetidin-1-yl]-3-pyridinyl]methyl]piperidin-4-yl]propanal.
| Compound Name | 3-[1-[[6-[3-(2,4-dioxo-1,3-diazinan-1-yl)azetidin-1-yl]-3-pyridinyl]methyl]piperidin-4-yl]propanal |
|---|---|
| PubChem CID | 171799872 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 3-[1-[[6-[3-(2,4-dioxo-1,3-diazinan-1-yl)azetidin-1-yl]-3-pyridinyl]methyl]piperidin-4-yl]propanal |
| SMILES | O=CCCC1CCN(Cc2ccc(N3CC(N4CCC(=O)NC4=O)C3)nc2)CC1 |
| InChI | InChI=1S/C21H29N5O3/c27-11-1-2-16-5-8-24(9-6-16)13-17-3-4-19(22-12-17)25-14-18(15-25)26-10-7-20(28)23-21(26)29/h3-4,11-12,16,18H,1-2,5-10,13-15H2,(H,23,28,29) |
| InChIKey | YFPITQKFFNIIRS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|