C16H30N2O2S — CID 171799925
3-methyl-1-[4-[[1-(sulfanylmethyl)pyrrolidin-3-yl]methoxy]piperidin-1-yl]butan-2-one (PubChem CID 171799925) has the molecular formula C16H30N2O2S and a molecular weight of 314.50 g/mol. Its IUPAC name is 3-methyl-1-[4-[[1-(sulfanylmethyl)pyrrolidin-3-yl]methoxy]piperidin-1-yl]butan-2-one.
| Compound Name | 3-methyl-1-[4-[[1-(sulfanylmethyl)pyrrolidin-3-yl]methoxy]piperidin-1-yl]butan-2-one |
|---|---|
| PubChem CID | 171799925 |
| Molecular Formula | C16H30N2O2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 3-methyl-1-[4-[[1-(sulfanylmethyl)pyrrolidin-3-yl]methoxy]piperidin-1-yl]butan-2-one |
| SMILES | CC(C)C(=O)CN1CCC(OCC2CCN(CS)C2)CC1 |
| InChI | InChI=1S/C16H30N2O2S/c1-13(2)16(19)10-17-7-4-15(5-8-17)20-11-14-3-6-18(9-14)12-21/h13-15,21H,3-12H2,1-2H3 |
| InChIKey | WUMHEZSSKFEMDI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|