C17H32N2O2S — CID 171799980
1-[3-[[1-(1-sulfanylethyl)piperidin-4-yl]oxymethyl]pyrrolidin-1-yl]pentan-3-one (PubChem CID 171799980) has the molecular formula C17H32N2O2S and a molecular weight of 328.52 g/mol. Its IUPAC name is 1-[3-[[1-(1-sulfanylethyl)piperidin-4-yl]oxymethyl]pyrrolidin-1-yl]pentan-3-one.
| Compound Name | 1-[3-[[1-(1-sulfanylethyl)piperidin-4-yl]oxymethyl]pyrrolidin-1-yl]pentan-3-one |
|---|---|
| PubChem CID | 171799980 |
| Molecular Formula | C17H32N2O2S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-[3-[[1-(1-sulfanylethyl)piperidin-4-yl]oxymethyl]pyrrolidin-1-yl]pentan-3-one |
| SMILES | CCC(=O)CCN1CCC(COC2CCN(C(C)S)CC2)C1 |
| InChI | InChI=1S/C17H32N2O2S/c1-3-16(20)5-9-18-8-4-15(12-18)13-21-17-6-10-19(11-7-17)14(2)22/h14-15,17,22H,3-13H2,1-2H3 |
| InChIKey | ZPNAXPWPEIWCQT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|