C26H31N5O2 — CID 171801686
2-[[2-[(cyclobutylmethylamino)methyl]-1H-indol-6-yl]methyl]-5-(3-hydroxypropylamino)-2,7-naphthyridin-1-one (PubChem CID 171801686) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 2-[[2-[(cyclobutylmethylamino)methyl]-1H-indol-6-yl]methyl]-5-(3-hydroxypropylamino)-2,7-naphthyridin-1-one.
| Compound Name | 2-[[2-[(cyclobutylmethylamino)methyl]-1H-indol-6-yl]methyl]-5-(3-hydroxypropylamino)-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 171801686 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 2-[[2-[(cyclobutylmethylamino)methyl]-1H-indol-6-yl]methyl]-5-(3-hydroxypropylamino)-2,7-naphthyridin-1-one |
| SMILES | O=c1c2cncc(NCCCO)c2ccn1Cc1ccc2cc(CNCC3CCC3)[nH]c2c1 |
| InChI | InChI=1S/C26H31N5O2/c32-10-2-8-29-25-16-28-15-23-22(25)7-9-31(26(23)33)17-19-5-6-20-12-21(30-24(20)11-19)14-27-13-18-3-1-4-18/h5-7,9,11-12,15-16,18,27,29-30,32H,1-4,8,10,13-14,17H2 |
| InChIKey | ZGYVAIQODRKCQO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|