C15H19N5 — CID 176815676
N-[[6-(azidomethyl)-1H-indol-2-yl]methyl]-1-cyclobutylmethanamine (PubChem CID 176815676) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is N-[[6-(azidomethyl)-1H-indol-2-yl]methyl]-1-cyclobutylmethanamine.
| Compound Name | N-[[6-(azidomethyl)-1H-indol-2-yl]methyl]-1-cyclobutylmethanamine |
|---|---|
| PubChem CID | 176815676 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-[[6-(azidomethyl)-1H-indol-2-yl]methyl]-1-cyclobutylmethanamine |
| SMILES | [N-]=[N+]=NCc1ccc2cc(CNCC3CCC3)[nH]c2c1 |
| InChI | InChI=1S/C15H19N5/c16-20-18-9-12-4-5-13-7-14(19-15(13)6-12)10-17-8-11-2-1-3-11/h4-7,11,17,19H,1-3,8-10H2 |
| InChIKey | HRBRMBWRKOXATI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|